C12H21F2O5P — CID 101002671
trans-ethyl (1R,2S)-2-[diethoxyphosphoryl(difluoro)methyl]-1-methylcyclopropane-1-carboxylate (PubChem CID 101002671) has the molecular formula C12H21F2O5P and a molecular weight of 314.27 g/mol. Its IUPAC name is trans-ethyl (1R,2S)-2-[diethoxyphosphoryl(difluoro)methyl]-1-methylcyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2S)-2-[diethoxyphosphoryl(difluoro)methyl]-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 101002671 |
| Molecular Formula | C12H21F2O5P |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | trans-ethyl (1R,2S)-2-[diethoxyphosphoryl(difluoro)methyl]-1-methylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)C[C@@H]1C(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C12H21F2O5P/c1-5-17-10(15)11(4)8-9(11)12(13,14)20(16,18-6-2)19-7-3/h9H,5-8H2,1-4H3/t9-,11+/m0/s1 |
| InChIKey | UULHCZBODZDKNN-GXSJLCMTSA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|