C11H21F2O5PS2 — CID 11485387
(3R,4R,6R)-6-[diethoxyphosphoryl(difluoro)methyl]-6-methylsulfanylthiane-3,4-diol (PubChem CID 11485387) has the molecular formula C11H21F2O5PS2 and a molecular weight of 366.39 g/mol. Its IUPAC name is (3R,4R,6R)-6-[diethoxyphosphoryl(difluoro)methyl]-6-methylsulfanylthiane-3,4-diol.
| Compound Name | (3R,4R,6R)-6-[diethoxyphosphoryl(difluoro)methyl]-6-methylsulfanylthiane-3,4-diol |
|---|---|
| PubChem CID | 11485387 |
| Molecular Formula | C11H21F2O5PS2 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (3R,4R,6R)-6-[diethoxyphosphoryl(difluoro)methyl]-6-methylsulfanylthiane-3,4-diol |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@@]1(SC)C[C@@H](O)[C@@H](O)CS1 |
| InChI | InChI=1S/C11H21F2O5PS2/c1-4-17-19(16,18-5-2)11(12,13)10(20-3)6-8(14)9(15)7-21-10/h8-9,14-15H,4-7H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | BOEVQLYQAYQQAW-KXUCPTDWSA-N |
| XLogP | 2.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|