C13H21F2O6P — CID 11078381
1-[diethoxyphosphoryl(difluoro)methyl]-4,4-dimethoxycyclohexa-2,5-dien-1-ol (PubChem CID 11078381) has the molecular formula C13H21F2O6P and a molecular weight of 342.28 g/mol. Its IUPAC name is 1-[diethoxyphosphoryl(difluoro)methyl]-4,4-dimethoxycyclohexa-2,5-dien-1-ol.
| Compound Name | 1-[diethoxyphosphoryl(difluoro)methyl]-4,4-dimethoxycyclohexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 11078381 |
| Molecular Formula | C13H21F2O6P |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-[diethoxyphosphoryl(difluoro)methyl]-4,4-dimethoxycyclohexa-2,5-dien-1-ol |
| SMILES | CCOP(=O)(OCC)C(F)(F)C1(O)C=CC(OC)(OC)C=C1 |
| InChI | InChI=1S/C13H21F2O6P/c1-5-20-22(17,21-6-2)13(14,15)11(16)7-9-12(18-3,19-4)10-8-11/h7-10,16H,5-6H2,1-4H3 |
| InChIKey | GSYNWWANVLGCQN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|