C8H14BrF2O3P — CID 14268059
2-bromo-4-diethoxyphosphoryl-4,4-difluorobut-1-ene (PubChem CID 14268059) has the molecular formula C8H14BrF2O3P and a molecular weight of 307.07 g/mol. Its IUPAC name is 2-bromo-4-diethoxyphosphoryl-4,4-difluorobut-1-ene.
| Compound Name | 2-bromo-4-diethoxyphosphoryl-4,4-difluorobut-1-ene |
|---|---|
| PubChem CID | 14268059 |
| Molecular Formula | C8H14BrF2O3P |
| Molecular Weight | 307.07 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 2-bromo-4-diethoxyphosphoryl-4,4-difluorobut-1-ene |
| SMILES | C=C(Br)CC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C8H14BrF2O3P/c1-4-13-15(12,14-5-2)8(10,11)6-7(3)9/h3-6H2,1-2H3 |
| InChIKey | VPWCLAXRLFWHSW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.07 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|