C17H29F2O9P — CID 101217225
(3aR,5R,6R,6aR)-6-[diethoxyphosphoryl(difluoro)methyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol (PubChem CID 101217225) has the molecular formula C17H29F2O9P and a molecular weight of 446.38 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-6-[diethoxyphosphoryl(difluoro)methyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6R,6aR)-6-[diethoxyphosphoryl(difluoro)methyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 101217225 |
| Molecular Formula | C17H29F2O9P |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (3aR,5R,6R,6aR)-6-[diethoxyphosphoryl(difluoro)methyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@@]1(O)[C@@H]([C@H]2COC(C)(C)O2)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H29F2O9P/c1-7-23-29(21,24-8-2)17(18,19)16(20)11(10-9-22-14(3,4)26-10)25-13-12(16)27-15(5,6)28-13/h10-13,20H,7-9H2,1-6H3/t10-,11-,12+,13-,16-/m1/s1 |
| InChIKey | JXYGTGPTMKLMRH-GUYIQFIESA-N |
| XLogP | 2.60 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|