C10H20NO4P — CID 10562555
(1S,4R)-4-(diethoxyphosphorylamino)cyclohex-2-en-1-ol (PubChem CID 10562555) has the molecular formula C10H20NO4P and a molecular weight of 249.25 g/mol. Its IUPAC name is (1S,4R)-4-(diethoxyphosphorylamino)cyclohex-2-en-1-ol.
| Compound Name | (1S,4R)-4-(diethoxyphosphorylamino)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 10562555 |
| Molecular Formula | C10H20NO4P |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (1S,4R)-4-(diethoxyphosphorylamino)cyclohex-2-en-1-ol |
| SMILES | CCOP(=O)(N[C@H]1C=C[C@@H](O)CC1)OCC |
| InChI | InChI=1S/C10H20NO4P/c1-3-14-16(13,15-4-2)11-9-5-7-10(12)8-6-9/h5,7,9-10,12H,3-4,6,8H2,1-2H3,(H,11,13)/t9-,10+/m0/s1 |
| InChIKey | TZTUBVNVPGFNTI-VHSXEESVSA-N |
| XLogP | 1.84 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|