C10H18NO4PS — CID 10826518
(1R,4S)-3-diethoxyphosphoryl-2λ4-thia-3-azabicyclo[2.2.2]oct-5-ene 2-oxide (PubChem CID 10826518) has the molecular formula C10H18NO4PS and a molecular weight of 279.30 g/mol. Its IUPAC name is (1R,4S)-3-diethoxyphosphoryl-2λ4-thia-3-azabicyclo[2.2.2]oct-5-ene 2-oxide.
| Compound Name | (1R,4S)-3-diethoxyphosphoryl-2λ4-thia-3-azabicyclo[2.2.2]oct-5-ene 2-oxide |
|---|---|
| PubChem CID | 10826518 |
| Molecular Formula | C10H18NO4PS |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (1R,4S)-3-diethoxyphosphoryl-2λ4-thia-3-azabicyclo[2.2.2]oct-5-ene 2-oxide |
| SMILES | CCOP(=O)(OCC)N1[C@@H]2C=C[C@@H](CC2)S1=O |
| InChI | InChI=1S/C10H18NO4PS/c1-3-14-16(12,15-4-2)11-9-5-7-10(8-6-9)17(11)13/h5,7,9-10H,3-4,6,8H2,1-2H3/t9-,10+,17?/m1/s1 |
| InChIKey | SZTHGCFYKCHCTO-ALJWHKCZSA-N |
| XLogP | 2.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|