C12H25N2O3P — CID 67045454
(3S,4S)-4-cyclopropyl-N-diethoxyphosphorylpiperidin-3-amine (PubChem CID 67045454) has the molecular formula C12H25N2O3P and a molecular weight of 276.32 g/mol. Its IUPAC name is (3S,4S)-4-cyclopropyl-N-diethoxyphosphorylpiperidin-3-amine.
| Compound Name | (3S,4S)-4-cyclopropyl-N-diethoxyphosphorylpiperidin-3-amine |
|---|---|
| PubChem CID | 67045454 |
| Molecular Formula | C12H25N2O3P |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (3S,4S)-4-cyclopropyl-N-diethoxyphosphorylpiperidin-3-amine |
| SMILES | CCOP(=O)(N[C@@H]1CNCC[C@H]1C1CC1)OCC |
| InChI | InChI=1S/C12H25N2O3P/c1-3-16-18(15,17-4-2)14-12-9-13-8-7-11(12)10-5-6-10/h10-13H,3-9H2,1-2H3,(H,14,15)/t11-,12+/m0/s1 |
| InChIKey | GUYKTJJGCNDECQ-NWDGAFQWSA-N |
| XLogP | 2.15 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|