C12H23O3P — CID 11413916
1-diethoxyphosphoryl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 11413916) has the molecular formula C12H23O3P and a molecular weight of 246.29 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 1-diethoxyphosphoryl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 11413916 |
| Molecular Formula | C12H23O3P |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-diethoxyphosphoryl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CCOP(=O)(OCC)C1CCC2CCCC21 |
| InChI | InChI=1S/C12H23O3P/c1-3-14-16(13,15-4-2)12-9-8-10-6-5-7-11(10)12/h10-12H,3-9H2,1-2H3 |
| InChIKey | VKYMKRNTDOWHNP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|