C13H26NO3P — CID 132581637
3-diethoxyphosphoryl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline (PubChem CID 132581637) has the molecular formula C13H26NO3P and a molecular weight of 275.33 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline.
| Compound Name | 3-diethoxyphosphoryl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
|---|---|
| PubChem CID | 132581637 |
| Molecular Formula | C13H26NO3P |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 3-diethoxyphosphoryl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
| SMILES | CCOP(=O)(OCC)C1CC2CCCCC2CN1 |
| InChI | InChI=1S/C13H26NO3P/c1-3-16-18(15,17-4-2)13-9-11-7-5-6-8-12(11)10-14-13/h11-14H,3-10H2,1-2H3 |
| InChIKey | NCZHTXSPNLXHLN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|