C10H20NO3P — CID 53473105
(2S,3aS,7aS)-2-dimethoxyphosphoryl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole (PubChem CID 53473105) has the molecular formula C10H20NO3P and a molecular weight of 233.25 g/mol. Its IUPAC name is (2S,3aS,7aS)-2-dimethoxyphosphoryl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole.
| Compound Name | (2S,3aS,7aS)-2-dimethoxyphosphoryl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
|---|---|
| PubChem CID | 53473105 |
| Molecular Formula | C10H20NO3P |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (2S,3aS,7aS)-2-dimethoxyphosphoryl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
| SMILES | COP(=O)(OC)[C@H]1C[C@@H]2CCCC[C@@H]2N1 |
| InChI | InChI=1S/C10H20NO3P/c1-13-15(12,14-2)10-7-8-5-3-4-6-9(8)11-10/h8-11H,3-7H2,1-2H3/t8-,9-,10-/m0/s1 |
| InChIKey | QZJOZHGWAZWQCO-GUBZILKMSA-N |
| XLogP | 2.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|