C11H23NO — CID 168977897
methanol;3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline (PubChem CID 168977897) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is methanol;3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline.
| Compound Name | methanol;3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
|---|---|
| PubChem CID | 168977897 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | methanol;3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
| SMILES | CC1CC2CCCCC2CN1.CO |
| InChI | InChI=1S/C10H19N.CH4O/c1-8-6-9-4-2-3-5-10(9)7-11-8;1-2/h8-11H,2-7H2,1H3;2H,1H3 |
| InChIKey | YENKOBBJYOUVJU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |