C12H23N — CID 59913049
(3S,4aS,8aS)-3-propan-2-yl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline (PubChem CID 59913049) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (3S,4aS,8aS)-3-propan-2-yl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline.
| Compound Name | (3S,4aS,8aS)-3-propan-2-yl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
|---|---|
| PubChem CID | 59913049 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (3S,4aS,8aS)-3-propan-2-yl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
| SMILES | CC(C)[C@@H]1C[C@@H]2CCCC[C@@H]2CN1 |
| InChI | InChI=1S/C12H23N/c1-9(2)12-7-10-5-3-4-6-11(10)8-13-12/h9-13H,3-8H2,1-2H3/t10-,11+,12-/m0/s1 |
| InChIKey | MDVINVXZFSDRCH-TUAOUCFPSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |