C8H17O4P — CID 15450659
[(1R,2S)-2-diethoxyphosphorylcyclopropyl]methanol (PubChem CID 15450659) has the molecular formula C8H17O4P and a molecular weight of 208.19 g/mol. Its IUPAC name is [(1R,2S)-2-diethoxyphosphorylcyclopropyl]methanol.
| Compound Name | [(1R,2S)-2-diethoxyphosphorylcyclopropyl]methanol |
|---|---|
| PubChem CID | 15450659 |
| Molecular Formula | C8H17O4P |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | [(1R,2S)-2-diethoxyphosphorylcyclopropyl]methanol |
| SMILES | CCOP(=O)(OCC)[C@H]1C[C@@H]1CO |
| InChI | InChI=1S/C8H17O4P/c1-3-11-13(10,12-4-2)8-5-7(8)6-9/h7-9H,3-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | SGLWXAJWRNRVRU-SFYZADRCSA-N |
| XLogP | 1.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|