C13H20N5O3P — CID 15450660
9-[[(1R,2S)-2-diethoxyphosphorylcyclopropyl]methyl]purin-6-amine (PubChem CID 15450660) has the molecular formula C13H20N5O3P and a molecular weight of 325.31 g/mol. Its IUPAC name is 9-[[(1R,2S)-2-diethoxyphosphorylcyclopropyl]methyl]purin-6-amine.
| Compound Name | 9-[[(1R,2S)-2-diethoxyphosphorylcyclopropyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 15450660 |
| Molecular Formula | C13H20N5O3P |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 9-[[(1R,2S)-2-diethoxyphosphorylcyclopropyl]methyl]purin-6-amine |
| SMILES | CCOP(=O)(OCC)[C@H]1C[C@@H]1Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H20N5O3P/c1-3-20-22(19,21-4-2)10-5-9(10)6-18-8-17-11-12(14)15-7-16-13(11)18/h7-10H,3-6H2,1-2H3,(H2,14,15,16)/t9-,10+/m1/s1 |
| InChIKey | CJCVLHAVWCWPLK-ZJUUUORDSA-N |
| XLogP | 2.06 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|