C11H16N5O7P — CID 59960729
[(2R,5S)-5-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 59960729) has the molecular formula C11H16N5O7P and a molecular weight of 361.25 g/mol. Its IUPAC name is [(2R,5S)-5-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,5S)-5-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59960729 |
| Molecular Formula | C11H16N5O7P |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | [(2R,5S)-5-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2C[C@@H]1O[C@H](COP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C11H16N5O7P/c12-10-7-11(14-3-13-10)16(4-15-7)1-5-8(17)9(18)6(23-5)2-22-24(19,20)21/h3-6,8-9,17-18H,1-2H2,(H2,12,13,14)(H2,19,20,21)/t5-,6+,8?,9?/m0/s1 |
| InChIKey | YKCGTJGNKVVHOU-LNWAWGKBSA-N |
| XLogP | -1.99 |
| TPSA | 186.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|