C16H27N2O6PS — CID 141374477
[4-(diethoxyphosphorylamino)piperidin-3-yl] 4-methylbenzenesulfonate (PubChem CID 141374477) has the molecular formula C16H27N2O6PS and a molecular weight of 406.44 g/mol. Its IUPAC name is [4-(diethoxyphosphorylamino)piperidin-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [4-(diethoxyphosphorylamino)piperidin-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 141374477 |
| Molecular Formula | C16H27N2O6PS |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [4-(diethoxyphosphorylamino)piperidin-3-yl] 4-methylbenzenesulfonate |
| SMILES | CCOP(=O)(NC1CCNCC1OS(=O)(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C16H27N2O6PS/c1-4-22-25(19,23-5-2)18-15-10-11-17-12-16(15)24-26(20,21)14-8-6-13(3)7-9-14/h6-9,15-17H,4-5,10-12H2,1-3H3,(H,18,19) |
| InChIKey | YYUORWKJPKGGLG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|