C20H31N2O5P — CID 101175893
benzyl (3S,4S)-4-cyclopropyl-3-(diethoxyphosphorylamino)piperidine-1-carboxylate (PubChem CID 101175893) has the molecular formula C20H31N2O5P and a molecular weight of 410.45 g/mol. Its IUPAC name is benzyl (3S,4S)-4-cyclopropyl-3-(diethoxyphosphorylamino)piperidine-1-carboxylate.
| Compound Name | benzyl (3S,4S)-4-cyclopropyl-3-(diethoxyphosphorylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 101175893 |
| Molecular Formula | C20H31N2O5P |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | benzyl (3S,4S)-4-cyclopropyl-3-(diethoxyphosphorylamino)piperidine-1-carboxylate |
| SMILES | CCOP(=O)(N[C@@H]1CN(C(=O)OCc2ccccc2)CC[C@H]1C1CC1)OCC |
| InChI | InChI=1S/C20H31N2O5P/c1-3-26-28(24,27-4-2)21-19-14-22(13-12-18(19)17-10-11-17)20(23)25-15-16-8-6-5-7-9-16/h5-9,17-19H,3-4,10-15H2,1-2H3,(H,21,24)/t18-,19+/m0/s1 |
| InChIKey | JPEMPGCPBAKNKS-RBUKOAKNSA-N |
| XLogP | 4.19 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|