About diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate
diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate (PubChem CID 177390470) has the molecular formula C10H21O5P
and a molecular weight of 252.25 g/mol. Its IUPAC name is diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate.
Molecular Properties
| Compound Name | diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate |
| PubChem CID | 177390470 |
| Molecular Formula | C10H21O5P |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate |
| SMILES | CCOP(=O)(OCC)O[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C10H21O5P/c1-3-13-16(12,14-4-2)15-10-8-6-5-7-9(10)11/h9-11H,3-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | PASDKOAOTTUDIY-ZJUUUORDSA-N |
| XLogP | 2.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate?
The IUPAC name of diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate (CID 177390470) is diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate.
What is the SMILES notation for diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate?
The canonical SMILES for diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate is CCOP(=O)(OCC)O[C@H]1CCCC[C@H]1O.
What is the InChIKey of diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate?
The InChIKey is PASDKOAOTTUDIY-ZJUUUORDSA-N. The full InChI is InChI=1S/C10H21O5P/c1-3-13-16(12,14-4-2)15-10-8-6-5-7-9(10)11/h9-11H,3-8H2,1-2H3/t9-,10+/m1/s1.
What are the key properties of diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate?
diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate has a molecular weight of 252.25 g/mol, XLogP of 2.49, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl [(1S,2R)-2-hydroxycyclohexyl] phosphate is sourced from PubChem (CID 177390470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).