C13H25O4P — CID 139263588
diethyl [(1R,2S)-2-ethylcyclohept-3-en-1-yl] phosphate (PubChem CID 139263588) has the molecular formula C13H25O4P and a molecular weight of 276.31 g/mol. Its IUPAC name is diethyl [(1R,2S)-2-ethylcyclohept-3-en-1-yl] phosphate.
| Compound Name | diethyl [(1R,2S)-2-ethylcyclohept-3-en-1-yl] phosphate |
|---|---|
| PubChem CID | 139263588 |
| Molecular Formula | C13H25O4P |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | diethyl [(1R,2S)-2-ethylcyclohept-3-en-1-yl] phosphate |
| SMILES | CCOP(=O)(OCC)O[C@@H]1CCCC=C[C@@H]1CC |
| InChI | InChI=1S/C13H25O4P/c1-4-12-10-8-7-9-11-13(12)17-18(14,15-5-2)16-6-3/h8,10,12-13H,4-7,9,11H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | HGJLBQJAHYBHHW-QWHCGFSZSA-N |
| XLogP | 4.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|