C11H21F2O4P — CID 11637796
1-[(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enoxy]butane (PubChem CID 11637796) has the molecular formula C11H21F2O4P and a molecular weight of 286.25 g/mol. Its IUPAC name is 1-[(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enoxy]butane.
| Compound Name | 1-[(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enoxy]butane |
|---|---|
| PubChem CID | 11637796 |
| Molecular Formula | C11H21F2O4P |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-[(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enoxy]butane |
| SMILES | CCCCO/C=C/C(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H21F2O4P/c1-4-7-9-15-10-8-11(12,13)18(14,16-5-2)17-6-3/h8,10H,4-7,9H2,1-3H3/b10-8+ |
| InChIKey | OZYWKUDOGXKKST-CSKARUKUSA-N |
| XLogP | 4.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|