About 1-diethoxyphosphoryl-1,1-difluorohept-2-yne
1-diethoxyphosphoryl-1,1-difluorohept-2-yne (PubChem CID 11737242) has the molecular formula C11H19F2O3P
and a molecular weight of 268.24 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluorohept-2-yne.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-1,1-difluorohept-2-yne |
| PubChem CID | 11737242 |
| Molecular Formula | C11H19F2O3P |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluorohept-2-yne |
| SMILES | CCCCC#CC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H19F2O3P/c1-4-7-8-9-10-11(12,13)17(14,15-5-2)16-6-3/h4-8H2,1-3H3 |
| InChIKey | AXYOLLOUFALHJW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-1,1-difluorohept-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-1,1-difluorohept-2-yne?
The IUPAC name of 1-diethoxyphosphoryl-1,1-difluorohept-2-yne (CID 11737242) is 1-diethoxyphosphoryl-1,1-difluorohept-2-yne.
What is the SMILES notation for 1-diethoxyphosphoryl-1,1-difluorohept-2-yne?
The canonical SMILES for 1-diethoxyphosphoryl-1,1-difluorohept-2-yne is CCCCC#CC(F)(F)P(=O)(OCC)OCC.
What is the InChIKey of 1-diethoxyphosphoryl-1,1-difluorohept-2-yne?
The InChIKey is AXYOLLOUFALHJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2O3P/c1-4-7-8-9-10-11(12,13)17(14,15-5-2)16-6-3/h4-8H2,1-3H3.
What are the key properties of 1-diethoxyphosphoryl-1,1-difluorohept-2-yne?
1-diethoxyphosphoryl-1,1-difluorohept-2-yne has a molecular weight of 268.24 g/mol, XLogP of 4.04, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-1,1-difluorohept-2-yne is sourced from PubChem (CID 11737242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).