C13H16F3O3P — CID 101098384
1-[(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]-4-fluorobenzene (PubChem CID 101098384) has the molecular formula C13H16F3O3P and a molecular weight of 308.24 g/mol. Its IUPAC name is 1-[(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]-4-fluorobenzene.
| Compound Name | 1-[(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 101098384 |
| Molecular Formula | C13H16F3O3P |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-[(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]-4-fluorobenzene |
| SMILES | CCOP(=O)(OCC)C(F)(F)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C13H16F3O3P/c1-3-18-20(17,19-4-2)13(15,16)10-9-11-5-7-12(14)8-6-11/h5-10H,3-4H2,1-2H3/b10-9+ |
| InChIKey | RJTOHMKKIZPELA-MDZDMXLPSA-N |
| XLogP | 4.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|