C17H22F3O4P — CID 10643348
1-[(1E,3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-dienyl]-4-methoxybenzene (PubChem CID 10643348) has the molecular formula C17H22F3O4P and a molecular weight of 378.33 g/mol. Its IUPAC name is 1-[(1E,3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-dienyl]-4-methoxybenzene.
| Compound Name | 1-[(1E,3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-dienyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 10643348 |
| Molecular Formula | C17H22F3O4P |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-[(1E,3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-dienyl]-4-methoxybenzene |
| SMILES | CCOP(=O)(OCC)/C(C)=C(\C=C\c1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H22F3O4P/c1-5-23-25(21,24-6-2)13(3)16(17(18,19)20)12-9-14-7-10-15(22-4)11-8-14/h7-12H,5-6H2,1-4H3/b12-9+,16-13+ |
| InChIKey | PHAGXFSRXVCNDJ-USJAFLQSSA-N |
| XLogP | 5.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|