C13H12F3NO2 — CID 7103417
(E)-6,6,6-trifluoro-5-imino-1-(4-methoxyphenyl)hex-1-en-3-one (PubChem CID 7103417) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is (E)-6,6,6-trifluoro-5-imino-1-(4-methoxyphenyl)hex-1-en-3-one.
| Compound Name | (E)-6,6,6-trifluoro-5-imino-1-(4-methoxyphenyl)hex-1-en-3-one |
|---|---|
| PubChem CID | 7103417 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (E)-6,6,6-trifluoro-5-imino-1-(4-methoxyphenyl)hex-1-en-3-one |
| SMILES | [H]/N=C(/CC(=O)/C=C/c1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO2/c1-19-11-6-3-9(4-7-11)2-5-10(18)8-12(17)13(14,15)16/h2-7,17H,8H2,1H3/b5-2+,17-12- |
| InChIKey | HUQMESOUIZJHPP-CTUPFIAASA-N |
| XLogP | 3.25 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|