C18H23F3O4 — CID 134932441
(E)-1-(4-methoxyphenyl)-5-[(2-methylpropan-2-yl)oxy]-5-(2,2,2-trifluoroethoxy)pent-1-en-3-one (PubChem CID 134932441) has the molecular formula C18H23F3O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-5-[(2-methylpropan-2-yl)oxy]-5-(2,2,2-trifluoroethoxy)pent-1-en-3-one.
| Compound Name | (E)-1-(4-methoxyphenyl)-5-[(2-methylpropan-2-yl)oxy]-5-(2,2,2-trifluoroethoxy)pent-1-en-3-one |
|---|---|
| PubChem CID | 134932441 |
| Molecular Formula | C18H23F3O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-5-[(2-methylpropan-2-yl)oxy]-5-(2,2,2-trifluoroethoxy)pent-1-en-3-one |
| SMILES | COc1ccc(/C=C/C(=O)CC(OCC(F)(F)F)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H23F3O4/c1-17(2,3)25-16(24-12-18(19,20)21)11-14(22)8-5-13-6-9-15(23-4)10-7-13/h5-10,16H,11-12H2,1-4H3/b8-5+ |
| InChIKey | BSVDSMIVNHDZKA-VMPITWQZSA-N |
| XLogP | 4.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|