C14H18O2S2 — CID 14642894
(E)-1-(4-methoxyphenyl)-5,5-bis(methylsulfanyl)pent-1-en-3-one (PubChem CID 14642894) has the molecular formula C14H18O2S2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-5,5-bis(methylsulfanyl)pent-1-en-3-one.
| Compound Name | (E)-1-(4-methoxyphenyl)-5,5-bis(methylsulfanyl)pent-1-en-3-one |
|---|---|
| PubChem CID | 14642894 |
| Molecular Formula | C14H18O2S2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-5,5-bis(methylsulfanyl)pent-1-en-3-one |
| SMILES | COc1ccc(/C=C/C(=O)CC(SC)SC)cc1 |
| InChI | InChI=1S/C14H18O2S2/c1-16-13-8-5-11(6-9-13)4-7-12(15)10-14(17-2)18-3/h4-9,14H,10H2,1-3H3/b7-4+ |
| InChIKey | PBVCIKJCDLSCNS-QPJJXVBHSA-N |
| XLogP | 3.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|