C14H19O6P — CID 102323559
(E)-2-diethoxyphosphoryl-3-(4-methoxyphenyl)prop-2-enoic acid (PubChem CID 102323559) has the molecular formula C14H19O6P and a molecular weight of 314.27 g/mol. Its IUPAC name is (E)-2-diethoxyphosphoryl-3-(4-methoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-diethoxyphosphoryl-3-(4-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 102323559 |
| Molecular Formula | C14H19O6P |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (E)-2-diethoxyphosphoryl-3-(4-methoxyphenyl)prop-2-enoic acid |
| SMILES | CCOP(=O)(OCC)/C(=C/c1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C14H19O6P/c1-4-19-21(17,20-5-2)13(14(15)16)10-11-6-8-12(18-3)9-7-11/h6-10H,4-5H2,1-3H3,(H,15,16)/b13-10+ |
| InChIKey | XSDPFKMLPAPJOW-JLHYYAGUSA-N |
| XLogP | 3.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|