C20H35O4PSi — CID 10692272
(E)-4-diethoxyphosphoryl-2-methyl-6-phenyl-4-trimethylsilylhex-5-en-3-ol (PubChem CID 10692272) has the molecular formula C20H35O4PSi and a molecular weight of 398.56 g/mol. Its IUPAC name is (E)-4-diethoxyphosphoryl-2-methyl-6-phenyl-4-trimethylsilylhex-5-en-3-ol.
| Compound Name | (E)-4-diethoxyphosphoryl-2-methyl-6-phenyl-4-trimethylsilylhex-5-en-3-ol |
|---|---|
| PubChem CID | 10692272 |
| Molecular Formula | C20H35O4PSi |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (E)-4-diethoxyphosphoryl-2-methyl-6-phenyl-4-trimethylsilylhex-5-en-3-ol |
| SMILES | CCOP(=O)(OCC)C(/C=C/c1ccccc1)(C(O)C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H35O4PSi/c1-8-23-25(22,24-9-2)20(26(5,6)7,19(21)17(3)4)16-15-18-13-11-10-12-14-18/h10-17,19,21H,8-9H2,1-7H3/b16-15+ |
| InChIKey | DRTMMJZRMFOXON-FOCLMDBBSA-N |
| XLogP | 5.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|