C17H25O5P — CID 129408619
ethyl (E,2S)-2-diethoxyphosphoryl-5-phenylpent-4-enoate (PubChem CID 129408619) has the molecular formula C17H25O5P and a molecular weight of 340.36 g/mol. Its IUPAC name is ethyl (E,2S)-2-diethoxyphosphoryl-5-phenylpent-4-enoate.
| Compound Name | ethyl (E,2S)-2-diethoxyphosphoryl-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 129408619 |
| Molecular Formula | C17H25O5P |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | ethyl (E,2S)-2-diethoxyphosphoryl-5-phenylpent-4-enoate |
| SMILES | CCOC(=O)[C@H](C/C=C/c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H25O5P/c1-4-20-17(18)16(23(19,21-5-2)22-6-3)14-10-13-15-11-8-7-9-12-15/h7-13,16H,4-6,14H2,1-3H3/b13-10+/t16-/m0/s1 |
| InChIKey | CHVFXHMFSGCDNM-ISBHARSQSA-N |
| XLogP | 4.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|