C26H39N2O5P — CID 102246538
(2S,5R)-2-[(2Z,4E)-2-diethoxyphosphoryl-5-phenylpenta-2,4-dienyl]-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 102246538) has the molecular formula C26H39N2O5P and a molecular weight of 490.58 g/mol. Its IUPAC name is (2S,5R)-2-[(2Z,4E)-2-diethoxyphosphoryl-5-phenylpenta-2,4-dienyl]-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine.
| Compound Name | (2S,5R)-2-[(2Z,4E)-2-diethoxyphosphoryl-5-phenylpenta-2,4-dienyl]-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 102246538 |
| Molecular Formula | C26H39N2O5P |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | (2S,5R)-2-[(2Z,4E)-2-diethoxyphosphoryl-5-phenylpenta-2,4-dienyl]-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | CCOC1=N[C@H](C(C)C)C(OCC)=N[C@H]1C/C(=C/C=C/c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C26H39N2O5P/c1-7-30-25-23(27-26(31-8-2)24(28-25)20(5)6)19-22(34(29,32-9-3)33-10-4)18-14-17-21-15-12-11-13-16-21/h11-18,20,23-24H,7-10,19H2,1-6H3/b17-14+,22-18-/t23-,24+/m0/s1 |
| InChIKey | IUGFQJWQTQQMCI-QFSRATTQSA-N |
| XLogP | 6.52 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|