C24H37N2O5P — CID 12963987
(2S,5R)-2-[(E)-2-diethoxyphosphoryl-3-phenylprop-2-enyl]-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 12963987) has the molecular formula C24H37N2O5P and a molecular weight of 464.54 g/mol. Its IUPAC name is (2S,5R)-2-[(E)-2-diethoxyphosphoryl-3-phenylprop-2-enyl]-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine.
| Compound Name | (2S,5R)-2-[(E)-2-diethoxyphosphoryl-3-phenylprop-2-enyl]-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 12963987 |
| Molecular Formula | C24H37N2O5P |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (2S,5R)-2-[(E)-2-diethoxyphosphoryl-3-phenylprop-2-enyl]-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | CCOC1=N[C@H](C(C)C)C(OCC)=N[C@H]1C/C(=C\c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C24H37N2O5P/c1-7-28-23-21(25-24(29-8-2)22(26-23)18(5)6)17-20(16-19-14-12-11-13-15-19)32(27,30-9-3)31-10-4/h11-16,18,21-22H,7-10,17H2,1-6H3/b20-16+/t21-,22+/m0/s1 |
| InChIKey | BJKUXRVLNWPDMC-PCONQCKZSA-N |
| XLogP | 5.96 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|