C23H34FN3O2Si — CID 100927485
[3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-fluoro-1H-indol-2-yl]-trimethylsilane (PubChem CID 100927485) has the molecular formula C23H34FN3O2Si and a molecular weight of 431.63 g/mol. Its IUPAC name is [3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-fluoro-1H-indol-2-yl]-trimethylsilane.
| Compound Name | [3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-fluoro-1H-indol-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 100927485 |
| Molecular Formula | C23H34FN3O2Si |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | [3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-fluoro-1H-indol-2-yl]-trimethylsilane |
| SMILES | CCOC1=N[C@H](C(C)C)C(OCC)=N[C@H]1Cc1c([Si](C)(C)C)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C23H34FN3O2Si/c1-8-28-21-19(25-22(29-9-2)20(27-21)14(3)4)13-17-16-12-15(24)10-11-18(16)26-23(17)30(5,6)7/h10-12,14,19-20,26H,8-9,13H2,1-7H3/t19-,20+/m0/s1 |
| InChIKey | MVWWMUIZTLELOQ-VQTJNVASSA-N |
| XLogP | 4.67 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|