C26H39Cl2N3O2Si — CID 10929451
[5,6-dichloro-3-[[(2R,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-1H-indol-2-yl]-triethylsilane (PubChem CID 10929451) has the molecular formula C26H39Cl2N3O2Si and a molecular weight of 524.61 g/mol. Its IUPAC name is [5,6-dichloro-3-[[(2R,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-1H-indol-2-yl]-triethylsilane.
| Compound Name | [5,6-dichloro-3-[[(2R,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-1H-indol-2-yl]-triethylsilane |
|---|---|
| PubChem CID | 10929451 |
| Molecular Formula | C26H39Cl2N3O2Si |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | [5,6-dichloro-3-[[(2R,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-1H-indol-2-yl]-triethylsilane |
| SMILES | CCOC1=N[C@H](Cc2c([Si](CC)(CC)CC)[nH]c3cc(Cl)c(Cl)cc23)C(OCC)=N[C@H]1C(C)C |
| InChI | InChI=1S/C26H39Cl2N3O2Si/c1-8-32-24-22(29-25(33-9-2)23(31-24)16(6)7)14-18-17-13-19(27)20(28)15-21(17)30-26(18)34(10-3,11-4)12-5/h13,15-16,22-23,30H,8-12,14H2,1-7H3/t22-,23+/m1/s1 |
| InChIKey | MIFHDSPMWVWWIH-PKTZIBPZSA-N |
| XLogP | 7.01 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|