C15H19Cl2N3O2 — CID 137480591
(2R,5S)-2-[(4,6-dichloro-3-pyridinyl)methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 137480591) has the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is (2R,5S)-2-[(4,6-dichloro-3-pyridinyl)methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine.
| Compound Name | (2R,5S)-2-[(4,6-dichloro-3-pyridinyl)methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 137480591 |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (2R,5S)-2-[(4,6-dichloro-3-pyridinyl)methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | COC1=N[C@H](Cc2cnc(Cl)cc2Cl)C(OC)=N[C@H]1C(C)C |
| InChI | InChI=1S/C15H19Cl2N3O2/c1-8(2)13-15(22-4)19-11(14(20-13)21-3)5-9-7-18-12(17)6-10(9)16/h6-8,11,13H,5H2,1-4H3/t11-,13+/m1/s1 |
| InChIKey | NEQGNCBHXDBYFJ-YPMHNXCESA-N |
| XLogP | 3.43 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|