C20H27N3O2 — CID 11186908
2-[3-[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]prop-1-ynyl]aniline (PubChem CID 11186908) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[3-[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]prop-1-ynyl]aniline.
| Compound Name | 2-[3-[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]prop-1-ynyl]aniline |
|---|---|
| PubChem CID | 11186908 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2-[3-[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]prop-1-ynyl]aniline |
| SMILES | CCOC1=N[C@H](C(C)C)C(OCC)=N[C@H]1CC#Cc1ccccc1N |
| InChI | InChI=1S/C20H27N3O2/c1-5-24-19-17(13-9-11-15-10-7-8-12-16(15)21)22-20(25-6-2)18(23-19)14(3)4/h7-8,10,12,14,17-18H,5-6,13,21H2,1-4H3/t17-,18+/m0/s1 |
| InChIKey | HKTMOXNUIRSQES-ZWKOTPCHSA-N |
| XLogP | 3.29 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|