C26H38N4O4 — CID 57165562
(2S,5R)-2-[[2-[[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]phenyl]methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 57165562) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is (2S,5R)-2-[[2-[[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]phenyl]methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine.
| Compound Name | (2S,5R)-2-[[2-[[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]phenyl]methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 57165562 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (2S,5R)-2-[[2-[[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]phenyl]methyl]-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | COC1=N[C@H](C(C)C)C(OC)=N[C@H]1Cc1ccccc1C[C@@H]1N=C(OC)[C@@H](C(C)C)N=C1OC |
| InChI | InChI=1S/C26H38N4O4/c1-15(2)21-25(33-7)27-19(23(29-21)31-5)13-17-11-9-10-12-18(17)14-20-24(32-6)30-22(16(3)4)26(28-20)34-8/h9-12,15-16,19-22H,13-14H2,1-8H3/t19-,20-,21+,22+/m0/s1 |
| InChIKey | IISWHKCWKPXDKY-FNAHDJPLSA-N |
| XLogP | 3.76 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |