C21H32N2O3S — CID 57113716
(2S,5R)-3,6-dimethoxy-2-[4-[(4-methoxyphenyl)methylsulfanyl]butyl]-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 57113716) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is (2S,5R)-3,6-dimethoxy-2-[4-[(4-methoxyphenyl)methylsulfanyl]butyl]-5-propan-2-yl-2,5-dihydropyrazine.
| Compound Name | (2S,5R)-3,6-dimethoxy-2-[4-[(4-methoxyphenyl)methylsulfanyl]butyl]-5-propan-2-yl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 57113716 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (2S,5R)-3,6-dimethoxy-2-[4-[(4-methoxyphenyl)methylsulfanyl]butyl]-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | COC1=N[C@H](C(C)C)C(OC)=N[C@H]1CCCCSCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H32N2O3S/c1-15(2)19-21(26-5)22-18(20(23-19)25-4)8-6-7-13-27-14-16-9-11-17(24-3)12-10-16/h9-12,15,18-19H,6-8,13-14H2,1-5H3/t18-,19+/m0/s1 |
| InChIKey | YWOISENETZBVJY-RBUKOAKNSA-N |
| XLogP | 4.60 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|