C16H31N3O2 — CID 54446328
5-[(2R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]pentan-1-amine (PubChem CID 54446328) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 5-[(2R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]pentan-1-amine.
| Compound Name | 5-[(2R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]pentan-1-amine |
|---|---|
| PubChem CID | 54446328 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 5-[(2R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]pentan-1-amine |
| SMILES | CCOC1=N[C@H](CCCCCN)C(OCC)=NC1C(C)C |
| InChI | InChI=1S/C16H31N3O2/c1-5-20-15-13(10-8-7-9-11-17)18-16(21-6-2)14(19-15)12(3)4/h12-14H,5-11,17H2,1-4H3/t13-,14?/m1/s1 |
| InChIKey | WRUCDBPDQCTGFI-KWCCSABGSA-N |
| XLogP | 2.78 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|