C20H36N2O2Si — CID 15484763
3-[(2S,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]prop-1-ynyl-triethylsilane (PubChem CID 15484763) has the molecular formula C20H36N2O2Si and a molecular weight of 364.61 g/mol. Its IUPAC name is 3-[(2S,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]prop-1-ynyl-triethylsilane.
| Compound Name | 3-[(2S,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]prop-1-ynyl-triethylsilane |
|---|---|
| PubChem CID | 15484763 |
| Molecular Formula | C20H36N2O2Si |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 3-[(2S,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]prop-1-ynyl-triethylsilane |
| SMILES | CCOC1=N[C@@H](C(C)C)C(OCC)=N[C@H]1CC#C[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H36N2O2Si/c1-8-23-19-17(14-13-15-25(10-3,11-4)12-5)21-20(24-9-2)18(22-19)16(6)7/h16-18H,8-12,14H2,1-7H3/t17-,18-/m0/s1 |
| InChIKey | GWCVAUZVNCCGIA-ROUUACIJSA-N |
| XLogP | 4.70 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|