C24H37N3O3Si — CID 100927484
[3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-6-methoxy-1H-indol-2-yl]-trimethylsilane (PubChem CID 100927484) has the molecular formula C24H37N3O3Si and a molecular weight of 443.66 g/mol. Its IUPAC name is [3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-6-methoxy-1H-indol-2-yl]-trimethylsilane.
| Compound Name | [3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-6-methoxy-1H-indol-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 100927484 |
| Molecular Formula | C24H37N3O3Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | [3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-6-methoxy-1H-indol-2-yl]-trimethylsilane |
| SMILES | CCOC1=N[C@H](C(C)C)C(OCC)=N[C@H]1Cc1c([Si](C)(C)C)[nH]c2cc(OC)ccc12 |
| InChI | InChI=1S/C24H37N3O3Si/c1-9-29-22-20(25-23(30-10-2)21(27-22)15(3)4)14-18-17-12-11-16(28-5)13-19(17)26-24(18)31(6,7)8/h11-13,15,20-21,26H,9-10,14H2,1-8H3/t20-,21+/m0/s1 |
| InChIKey | SEWBDWPXCYKKNL-LEWJYISDSA-N |
| XLogP | 4.54 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|