C22H34N2O4Si — CID 90817567
tert-butyl (3S)-3-[(6-methoxy-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylate (PubChem CID 90817567) has the molecular formula C22H34N2O4Si and a molecular weight of 418.61 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(6-methoxy-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(6-methoxy-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 90817567 |
| Molecular Formula | C22H34N2O4Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | tert-butyl (3S)-3-[(6-methoxy-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylate |
| SMILES | COc1ccc2c(C[C@H]3COCCN3C(=O)OC(C)(C)C)c([Si](C)(C)C)[nH]c2c1 |
| InChI | InChI=1S/C22H34N2O4Si/c1-22(2,3)28-21(25)24-10-11-27-14-15(24)12-18-17-9-8-16(26-4)13-19(17)23-20(18)29(5,6)7/h8-9,13,15,23H,10-12,14H2,1-7H3/t15-/m0/s1 |
| InChIKey | HSMTULGSJHQXKS-HNNXBMFYSA-N |
| XLogP | 3.90 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|