C23H33ClN2O5Si — CID 67185751
tert-butyl (3S)-3-[(5-chloro-7-methoxycarbonyl-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylate (PubChem CID 67185751) has the molecular formula C23H33ClN2O5Si and a molecular weight of 481.07 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(5-chloro-7-methoxycarbonyl-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(5-chloro-7-methoxycarbonyl-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 67185751 |
| Molecular Formula | C23H33ClN2O5Si |
| Molecular Weight | 481.07 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | tert-butyl (3S)-3-[(5-chloro-7-methoxycarbonyl-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylate |
| SMILES | COC(=O)c1cc(Cl)cc2c(C[C@H]3COCCN3C(=O)OC(C)(C)C)c([Si](C)(C)C)[nH]c12 |
| InChI | InChI=1S/C23H33ClN2O5Si/c1-23(2,3)31-22(28)26-8-9-30-13-15(26)12-17-16-10-14(24)11-18(21(27)29-4)19(16)25-20(17)32(5,6)7/h10-11,15,25H,8-9,12-13H2,1-7H3/t15-/m0/s1 |
| InChIKey | TYQVKXFSSBFDTG-HNNXBMFYSA-N |
| XLogP | 4.33 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.07 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|