C18H26N2O4Si — CID 67186824
(3S)-3-[(6-methoxy-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylic acid (PubChem CID 67186824) has the molecular formula C18H26N2O4Si and a molecular weight of 362.50 g/mol. Its IUPAC name is (3S)-3-[(6-methoxy-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylic acid.
| Compound Name | (3S)-3-[(6-methoxy-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 67186824 |
| Molecular Formula | C18H26N2O4Si |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (3S)-3-[(6-methoxy-2-trimethylsilyl-1H-indol-3-yl)methyl]morpholine-4-carboxylic acid |
| SMILES | COc1ccc2c(C[C@H]3COCCN3C(=O)O)c([Si](C)(C)C)[nH]c2c1 |
| InChI | InChI=1S/C18H26N2O4Si/c1-23-13-5-6-14-15(17(25(2,3)4)19-16(14)10-13)9-12-11-24-8-7-20(12)18(21)22/h5-6,10,12,19H,7-9,11H2,1-4H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | IHPTYARMBQOZAF-LBPRGKRZSA-N |
| XLogP | 2.64 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|