C17H22N2O7 — CID 50971214
2-[4-[3-(2,4-dimethoxyanilino)-3-oxopropanoyl]morpholin-3-yl]acetic acid (PubChem CID 50971214) has the molecular formula C17H22N2O7 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-[4-[3-(2,4-dimethoxyanilino)-3-oxopropanoyl]morpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(2,4-dimethoxyanilino)-3-oxopropanoyl]morpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 50971214 |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-[4-[3-(2,4-dimethoxyanilino)-3-oxopropanoyl]morpholin-3-yl]acetic acid |
| SMILES | COc1ccc(NC(=O)CC(=O)N2CCOCC2CC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C17H22N2O7/c1-24-12-3-4-13(14(8-12)25-2)18-15(20)9-16(21)19-5-6-26-10-11(19)7-17(22)23/h3-4,8,11H,5-7,9-10H2,1-2H3,(H,18,20)(H,22,23) |
| InChIKey | BLFDKXPXTDTYQL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|