C24H36N2O5Si — CID 66852556
tert-butyl (3S)-3-[(5-methoxycarbonyl-1-methyl-2-trimethylsilylindol-3-yl)methyl]morpholine-4-carboxylate (PubChem CID 66852556) has the molecular formula C24H36N2O5Si and a molecular weight of 460.65 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(5-methoxycarbonyl-1-methyl-2-trimethylsilylindol-3-yl)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(5-methoxycarbonyl-1-methyl-2-trimethylsilylindol-3-yl)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 66852556 |
| Molecular Formula | C24H36N2O5Si |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | tert-butyl (3S)-3-[(5-methoxycarbonyl-1-methyl-2-trimethylsilylindol-3-yl)methyl]morpholine-4-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c(C[C@H]1COCCN1C(=O)OC(C)(C)C)c([Si](C)(C)C)n2C |
| InChI | InChI=1S/C24H36N2O5Si/c1-24(2,3)31-23(28)26-11-12-30-15-17(26)14-19-18-13-16(22(27)29-5)9-10-20(18)25(4)21(19)32(6,7)8/h9-10,13,17H,11-12,14-15H2,1-8H3/t17-/m0/s1 |
| InChIKey | ULLAFUBLJFIYKP-KRWDZBQOSA-N |
| XLogP | 3.69 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|