C18H26N6O3 — CID 59313903
tert-butyl 3-[[4-amino-2-(1,2,4-triazol-4-yl)anilino]methyl]morpholine-4-carboxylate (PubChem CID 59313903) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is tert-butyl 3-[[4-amino-2-(1,2,4-triazol-4-yl)anilino]methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[[4-amino-2-(1,2,4-triazol-4-yl)anilino]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 59313903 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | tert-butyl 3-[[4-amino-2-(1,2,4-triazol-4-yl)anilino]methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1CNc1ccc(N)cc1-n1cnnc1 |
| InChI | InChI=1S/C18H26N6O3/c1-18(2,3)27-17(25)24-6-7-26-10-14(24)9-20-15-5-4-13(19)8-16(15)23-11-21-22-12-23/h4-5,8,11-12,14,20H,6-7,9-10,19H2,1-3H3 |
| InChIKey | OVDDCTKCIQZWMH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|