C24H37N3O2Si — CID 10916938
[3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-methyl-1H-indol-2-yl]-trimethylsilane (PubChem CID 10916938) has the molecular formula C24H37N3O2Si and a molecular weight of 427.67 g/mol. Its IUPAC name is [3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-methyl-1H-indol-2-yl]-trimethylsilane.
| Compound Name | [3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-methyl-1H-indol-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 10916938 |
| Molecular Formula | C24H37N3O2Si |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | [3-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-methyl-1H-indol-2-yl]-trimethylsilane |
| SMILES | CCOC1=N[C@H](C(C)C)C(OCC)=N[C@H]1Cc1c([Si](C)(C)C)[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C24H37N3O2Si/c1-9-28-22-20(25-23(29-10-2)21(27-22)15(3)4)14-18-17-13-16(5)11-12-19(17)26-24(18)30(6,7)8/h11-13,15,20-21,26H,9-10,14H2,1-8H3/t20-,21+/m0/s1 |
| InChIKey | HBOCMOIOHITTJH-LEWJYISDSA-N |
| XLogP | 4.84 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|