C27H43N3O3Si — CID 11827010
[2-[[(2R,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-methoxy-1H-indol-3-yl]-triethylsilane (PubChem CID 11827010) has the molecular formula C27H43N3O3Si and a molecular weight of 485.75 g/mol. Its IUPAC name is [2-[[(2R,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-methoxy-1H-indol-3-yl]-triethylsilane.
| Compound Name | [2-[[(2R,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-methoxy-1H-indol-3-yl]-triethylsilane |
|---|---|
| PubChem CID | 11827010 |
| Molecular Formula | C27H43N3O3Si |
| Molecular Weight | 485.75 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | [2-[[(2R,5S)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-5-methoxy-1H-indol-3-yl]-triethylsilane |
| SMILES | CCOC1=N[C@H](Cc2[nH]c3ccc(OC)cc3c2[Si](CC)(CC)CC)C(OCC)=N[C@H]1C(C)C |
| InChI | InChI=1S/C27H43N3O3Si/c1-9-32-26-23(29-27(33-10-2)24(30-26)18(6)7)17-22-25(34(11-3,12-4)13-5)20-16-19(31-8)14-15-21(20)28-22/h14-16,18,23-24,28H,9-13,17H2,1-8H3/t23-,24+/m1/s1 |
| InChIKey | OAWRIZZFLSQWQP-RPWUZVMVSA-N |
| XLogP | 5.71 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.75 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|