C13H24N2O2 — CID 100935179
(2S,5S)-3,6-diethoxy-2-ethyl-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 100935179) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (2S,5S)-3,6-diethoxy-2-ethyl-5-propan-2-yl-2,5-dihydropyrazine.
| Compound Name | (2S,5S)-3,6-diethoxy-2-ethyl-5-propan-2-yl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 100935179 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | (2S,5S)-3,6-diethoxy-2-ethyl-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | CCOC1=N[C@@H](C(C)C)C(OCC)=N[C@H]1CC |
| InChI | InChI=1S/C13H24N2O2/c1-6-10-12(16-7-2)15-11(9(4)5)13(14-10)17-8-3/h9-11H,6-8H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | YIXXMMLVVXLJES-QWRGUYRKSA-N |
| XLogP | 2.67 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |